C7H6FNO2S — CID 164681134
2-[(1R,2R,3R)-2-fluoro-3-nitrocyclopropyl]thiophene (PubChem CID 164681134) has the molecular formula C7H6FNO2S and a molecular weight of 187.19 g/mol. Its IUPAC name is 2-[(1R,2R,3R)-2-fluoro-3-nitrocyclopropyl]thiophene.
| Compound Name | 2-[(1R,2R,3R)-2-fluoro-3-nitrocyclopropyl]thiophene |
|---|---|
| PubChem CID | 164681134 |
| Molecular Formula | C7H6FNO2S |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.01 |
| IUPAC Name | 2-[(1R,2R,3R)-2-fluoro-3-nitrocyclopropyl]thiophene |
| SMILES | O=[N+]([O-])[C@H]1[C@H](F)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C7H6FNO2S/c8-6-5(7(6)9(10)11)4-2-1-3-12-4/h1-3,5-7H/t5-,6+,7+/m0/s1 |
| InChIKey | CRLKWZSFGKXCAY-RRKCRQDMSA-N |
| XLogP | 1.83 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|