C25H20OS — CID 164681205
(2S,4S)-2-naphthalen-1-ylsulfanyl-4-phenyl-3,4-dihydro-2H-chromene (PubChem CID 164681205) has the molecular formula C25H20OS and a molecular weight of 368.50 g/mol. Its IUPAC name is (2S,4S)-2-naphthalen-1-ylsulfanyl-4-phenyl-3,4-dihydro-2H-chromene.
| Compound Name | (2S,4S)-2-naphthalen-1-ylsulfanyl-4-phenyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 164681205 |
| Molecular Formula | C25H20OS |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | (2S,4S)-2-naphthalen-1-ylsulfanyl-4-phenyl-3,4-dihydro-2H-chromene |
| SMILES | c1ccc([C@@H]2C[C@H](Sc3cccc4ccccc34)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C25H20OS/c1-2-9-19(10-3-1)22-17-25(26-23-15-7-6-14-21(22)23)27-24-16-8-12-18-11-4-5-13-20(18)24/h1-16,22,25H,17H2/t22-,25-/m0/s1 |
| InChIKey | OVBMIFNZPZRWSD-DHLKQENFSA-N |
| XLogP | 6.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |