C11H18O — CID 164681574
(4R)-2,4-dimethyl-4a,5,6,7,8,8a-hexahydro-4H-chromene (PubChem CID 164681574) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (4R)-2,4-dimethyl-4a,5,6,7,8,8a-hexahydro-4H-chromene.
| Compound Name | (4R)-2,4-dimethyl-4a,5,6,7,8,8a-hexahydro-4H-chromene |
|---|---|
| PubChem CID | 164681574 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (4R)-2,4-dimethyl-4a,5,6,7,8,8a-hexahydro-4H-chromene |
| SMILES | CC1=C[C@H](C)C2CCCCC2O1 |
| InChI | InChI=1S/C11H18O/c1-8-7-9(2)12-11-6-4-3-5-10(8)11/h7-8,10-11H,3-6H2,1-2H3/t8-,10?,11?/m0/s1 |
| InChIKey | GGIJRRIQBPFUAT-PUSIOWJLSA-N |
| XLogP | 3.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |