C13H11F9N2O3 — CID 164681704
3-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1-(oxolan-2-yl)pyrimidine-2,4-dione (PubChem CID 164681704) has the molecular formula C13H11F9N2O3 and a molecular weight of 414.22 g/mol. Its IUPAC name is 3-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1-(oxolan-2-yl)pyrimidine-2,4-dione.
| Compound Name | 3-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1-(oxolan-2-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 164681704 |
| Molecular Formula | C13H11F9N2O3 |
| Molecular Weight | 414.22 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 3-methyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1-(oxolan-2-yl)pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cn(C2CCCO2)c1=O |
| InChI | InChI=1S/C13H11F9N2O3/c1-23-8(25)6(5-24(9(23)26)7-3-2-4-27-7)10(14,15)11(16,17)12(18,19)13(20,21)22/h5,7H,2-4H2,1H3 |
| InChIKey | WNAXPFSFLYTSMP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|