C14H13F3O2 — CID 164681869
6-[(2S)-1,1,1-trifluoro-2-(hydroxymethyl)but-3-en-2-yl]-2,3-dihydroinden-1-one (PubChem CID 164681869) has the molecular formula C14H13F3O2 and a molecular weight of 270.25 g/mol. Its IUPAC name is 6-[(2S)-1,1,1-trifluoro-2-(hydroxymethyl)but-3-en-2-yl]-2,3-dihydroinden-1-one.
| Compound Name | 6-[(2S)-1,1,1-trifluoro-2-(hydroxymethyl)but-3-en-2-yl]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 164681869 |
| Molecular Formula | C14H13F3O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 6-[(2S)-1,1,1-trifluoro-2-(hydroxymethyl)but-3-en-2-yl]-2,3-dihydroinden-1-one |
| SMILES | C=C[C@@](CO)(c1ccc2c(c1)C(=O)CC2)C(F)(F)F |
| InChI | InChI=1S/C14H13F3O2/c1-2-13(8-18,14(15,16)17)10-5-3-9-4-6-12(19)11(9)7-10/h2-3,5,7,18H,1,4,6,8H2/t13-/m1/s1 |
| InChIKey | BKPBATGSJINCQD-CYBMUJFWSA-N |
| XLogP | 2.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|