C15H29ClN2O2Si — CID 164681915
chloromethyl-[[(2R,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-dimethylsilane (PubChem CID 164681915) has the molecular formula C15H29ClN2O2Si and a molecular weight of 332.95 g/mol. Its IUPAC name is chloromethyl-[[(2R,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-dimethylsilane.
| Compound Name | chloromethyl-[[(2R,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-dimethylsilane |
|---|---|
| PubChem CID | 164681915 |
| Molecular Formula | C15H29ClN2O2Si |
| Molecular Weight | 332.95 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | chloromethyl-[[(2R,5R)-3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl]methyl]-dimethylsilane |
| SMILES | CCOC1=N[C@H](C(C)C)C(OCC)=N[C@H]1C[Si](C)(C)CCl |
| InChI | InChI=1S/C15H29ClN2O2Si/c1-7-19-14-12(9-21(5,6)10-16)17-15(20-8-2)13(18-14)11(3)4/h11-13H,7-10H2,1-6H3/t12-,13+/m0/s1 |
| InChIKey | KGJMLJPWJGGKPJ-QWHCGFSZSA-N |
| XLogP | 3.75 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.95 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|