C18H11BrF3N3O4 — CID 164682028
3-(4-bromophenyl)-2-(2,4-dinitrophenyl)-1-methyl-5-(trifluoromethyl)pyrrole (PubChem CID 164682028) has the molecular formula C18H11BrF3N3O4 and a molecular weight of 470.20 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2-(2,4-dinitrophenyl)-1-methyl-5-(trifluoromethyl)pyrrole.
| Compound Name | 3-(4-bromophenyl)-2-(2,4-dinitrophenyl)-1-methyl-5-(trifluoromethyl)pyrrole |
|---|---|
| PubChem CID | 164682028 |
| Molecular Formula | C18H11BrF3N3O4 |
| Molecular Weight | 470.20 g/mol |
| Exact Mass | 468.99 |
| IUPAC Name | 3-(4-bromophenyl)-2-(2,4-dinitrophenyl)-1-methyl-5-(trifluoromethyl)pyrrole |
| SMILES | Cn1c(C(F)(F)F)cc(-c2ccc(Br)cc2)c1-c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H11BrF3N3O4/c1-23-16(18(20,21)22)9-14(10-2-4-11(19)5-3-10)17(23)13-7-6-12(24(26)27)8-15(13)25(28)29/h2-9H,1H3 |
| InChIKey | AXKJHCKDZQJGLG-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 91.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.20 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|