About 2,3-bis(4-fluorophenyl)-1,2'-spirobi[indene]-1',3'-dione
2,3-bis(4-fluorophenyl)-1,2'-spirobi[indene]-1',3'-dione (PubChem CID 164682123) has the molecular formula C29H16F2O2
and a molecular weight of 434.44 g/mol. Its IUPAC name is 2,3-bis(4-fluorophenyl)-1,2'-spirobi[indene]-1',3'-dione.
Molecular Properties
| Compound Name | 2,3-bis(4-fluorophenyl)-1,2'-spirobi[indene]-1',3'-dione |
| PubChem CID | 164682123 |
| Molecular Formula | C29H16F2O2 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 2,3-bis(4-fluorophenyl)-1,2'-spirobi[indene]-1',3'-dione |
| SMILES | O=C1c2ccccc2C(=O)C12C(c1ccc(F)cc1)=C(c1ccc(F)cc1)c1ccccc12 |
| InChI | InChI=1S/C29H16F2O2/c30-19-13-9-17(10-14-19)25-23-7-3-4-8-24(23)29(26(25)18-11-15-20(31)16-12-18)27(32)21-5-1-2-6-22(21)28(29)33/h1-16H |
| InChIKey | DCFNJULXHRKPAR-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(4-fluorophenyl)-1,2'-spirobi[indene]-1',3'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(4-fluorophenyl)-1,2'-spirobi[indene]-1',3'-dione?
The IUPAC name of 2,3-bis(4-fluorophenyl)-1,2'-spirobi[indene]-1',3'-dione (CID 164682123) is 2,3-bis(4-fluorophenyl)-1,2'-spirobi[indene]-1',3'-dione.
What is the SMILES notation for 2,3-bis(4-fluorophenyl)-1,2'-spirobi[indene]-1',3'-dione?
The canonical SMILES for 2,3-bis(4-fluorophenyl)-1,2'-spirobi[indene]-1',3'-dione is O=C1c2ccccc2C(=O)C12C(c1ccc(F)cc1)=C(c1ccc(F)cc1)c1ccccc12.
What is the InChIKey of 2,3-bis(4-fluorophenyl)-1,2'-spirobi[indene]-1',3'-dione?
The InChIKey is DCFNJULXHRKPAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H16F2O2/c30-19-13-9-17(10-14-19)25-23-7-3-4-8-24(23)29(26(25)18-11-15-20(31)16-12-18)27(32)21-5-1-2-6-22(21)28(29)33/h1-16H.
What are the key properties of 2,3-bis(4-fluorophenyl)-1,2'-spirobi[indene]-1',3'-dione?
2,3-bis(4-fluorophenyl)-1,2'-spirobi[indene]-1',3'-dione has a molecular weight of 434.44 g/mol, XLogP of 6.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(4-fluorophenyl)-1,2'-spirobi[indene]-1',3'-dione is sourced from PubChem (CID 164682123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).