C29H16F2O2 — CID 164682123
2,3-bis(4-fluorophenyl)-1,2'-spirobi[indene]-1',3'-dione (PubChem CID 164682123) has the molecular formula C29H16F2O2 and a molecular weight of 434.44 g/mol. Its IUPAC name is 2,3-bis(4-fluorophenyl)-1,2'-spirobi[indene]-1',3'-dione.
| Compound Name | 2,3-bis(4-fluorophenyl)-1,2'-spirobi[indene]-1',3'-dione |
|---|---|
| PubChem CID | 164682123 |
| Molecular Formula | C29H16F2O2 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 2,3-bis(4-fluorophenyl)-1,2'-spirobi[indene]-1',3'-dione |
| SMILES | O=C1c2ccccc2C(=O)C12C(c1ccc(F)cc1)=C(c1ccc(F)cc1)c1ccccc12 |
| InChI | InChI=1S/C29H16F2O2/c30-19-13-9-17(10-14-19)25-23-7-3-4-8-24(23)29(26(25)18-11-15-20(31)16-12-18)27(32)21-5-1-2-6-22(21)28(29)33/h1-16H |
| InChIKey | DCFNJULXHRKPAR-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|