C32H57NO8Si2 — CID 164682220
benzyl (2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(1S)-2-(2,2-dimethylpropanoyloxy)-1-hydroxyethyl]-4-hydroxypyrrolidine-1-carboxylate (PubChem CID 164682220) has the molecular formula C32H57NO8Si2 and a molecular weight of 639.98 g/mol. Its IUPAC name is benzyl (2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(1S)-2-(2,2-dimethylpropanoyloxy)-1-hydroxyethyl]-4-hydroxypyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(1S)-2-(2,2-dimethylpropanoyloxy)-1-hydroxyethyl]-4-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 164682220 |
| Molecular Formula | C32H57NO8Si2 |
| Molecular Weight | 639.98 g/mol |
| Exact Mass | 639.36 |
| IUPAC Name | benzyl (2R,3R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(1S)-2-(2,2-dimethylpropanoyloxy)-1-hydroxyethyl]-4-hydroxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)C(=O)OC[C@@H](O)[C@@H]1[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H57NO8Si2/c1-30(2,3)28(36)38-21-24(34)25-26(35)27(41-43(12,13)32(7,8)9)23(20-40-42(10,11)31(4,5)6)33(25)29(37)39-19-22-17-15-14-16-18-22/h14-18,23-27,34-35H,19-21H2,1-13H3/t23-,24-,25-,26-,27-/m1/s1 |
| InChIKey | YZZMTKOBXOMCNT-RFNQJFSXSA-N |
| XLogP | 6.10 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.98 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|