C11H12F7N5 — CID 164682313
4-(1,1,2,2,3,3,3-heptafluoropropyl)-6-piperidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 164682313) has the molecular formula C11H12F7N5 and a molecular weight of 347.24 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,3-heptafluoropropyl)-6-piperidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(1,1,2,2,3,3,3-heptafluoropropyl)-6-piperidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 164682313 |
| Molecular Formula | C11H12F7N5 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 4-(1,1,2,2,3,3,3-heptafluoropropyl)-6-piperidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(N2CCCCC2)nc(C(F)(F)C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C11H12F7N5/c12-9(13,10(14,15)11(16,17)18)6-20-7(19)22-8(21-6)23-4-2-1-3-5-23/h1-5H2,(H2,19,20,21,22) |
| InChIKey | KPFWICOUNXNWNZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|