About 4'-phenylspiro[2,4-dihydro-1H-naphthalene-3,6'-piperidine]-2'-one
4'-phenylspiro[2,4-dihydro-1H-naphthalene-3,6'-piperidine]-2'-one (PubChem CID 164682376) has the molecular formula C20H21NO
and a molecular weight of 291.39 g/mol. Its IUPAC name is 4'-phenylspiro[2,4-dihydro-1H-naphthalene-3,6'-piperidine]-2'-one.
Molecular Properties
| Compound Name | 4'-phenylspiro[2,4-dihydro-1H-naphthalene-3,6'-piperidine]-2'-one |
| PubChem CID | 164682376 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 4'-phenylspiro[2,4-dihydro-1H-naphthalene-3,6'-piperidine]-2'-one |
| SMILES | O=C1CC(c2ccccc2)CC2(CCc3ccccc3C2)N1 |
| InChI | InChI=1S/C20H21NO/c22-19-12-18(15-6-2-1-3-7-15)14-20(21-19)11-10-16-8-4-5-9-17(16)13-20/h1-9,18H,10-14H2,(H,21,22) |
| InChIKey | AVSWCYYSJRFQNP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4'-phenylspiro[2,4-dihydro-1H-naphthalene-3,6'-piperidine]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-phenylspiro[2,4-dihydro-1H-naphthalene-3,6'-piperidine]-2'-one?
The IUPAC name of 4'-phenylspiro[2,4-dihydro-1H-naphthalene-3,6'-piperidine]-2'-one (CID 164682376) is 4'-phenylspiro[2,4-dihydro-1H-naphthalene-3,6'-piperidine]-2'-one.
What is the SMILES notation for 4'-phenylspiro[2,4-dihydro-1H-naphthalene-3,6'-piperidine]-2'-one?
The canonical SMILES for 4'-phenylspiro[2,4-dihydro-1H-naphthalene-3,6'-piperidine]-2'-one is O=C1CC(c2ccccc2)CC2(CCc3ccccc3C2)N1.
What is the InChIKey of 4'-phenylspiro[2,4-dihydro-1H-naphthalene-3,6'-piperidine]-2'-one?
The InChIKey is AVSWCYYSJRFQNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO/c22-19-12-18(15-6-2-1-3-7-15)14-20(21-19)11-10-16-8-4-5-9-17(16)13-20/h1-9,18H,10-14H2,(H,21,22).
What are the key properties of 4'-phenylspiro[2,4-dihydro-1H-naphthalene-3,6'-piperidine]-2'-one?
4'-phenylspiro[2,4-dihydro-1H-naphthalene-3,6'-piperidine]-2'-one has a molecular weight of 291.39 g/mol, XLogP of 3.61, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-phenylspiro[2,4-dihydro-1H-naphthalene-3,6'-piperidine]-2'-one is sourced from PubChem (CID 164682376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).