About (3S,4S)-2-aminopyrrolidine-3,4-diol
(3S,4S)-2-aminopyrrolidine-3,4-diol (PubChem CID 164682400) has the molecular formula C4H10N2O2
and a molecular weight of 118.14 g/mol. Its IUPAC name is (3S,4S)-2-aminopyrrolidine-3,4-diol.
Molecular Properties
| Compound Name | (3S,4S)-2-aminopyrrolidine-3,4-diol |
| PubChem CID | 164682400 |
| Molecular Formula | C4H10N2O2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.07 |
| IUPAC Name | (3S,4S)-2-aminopyrrolidine-3,4-diol |
| SMILES | NC1NC[C@H](O)[C@H]1O |
| InChI | InChI=1S/C4H10N2O2/c5-4-3(8)2(7)1-6-4/h2-4,6-8H,1,5H2/t2-,3+,4?/m0/s1 |
| InChIKey | CUVIIWDDZNHFGS-URORKIPUSA-N |
| XLogP | -2.40 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S,4S)-2-aminopyrrolidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-2-aminopyrrolidine-3,4-diol?
The IUPAC name of (3S,4S)-2-aminopyrrolidine-3,4-diol (CID 164682400) is (3S,4S)-2-aminopyrrolidine-3,4-diol.
What is the SMILES notation for (3S,4S)-2-aminopyrrolidine-3,4-diol?
The canonical SMILES for (3S,4S)-2-aminopyrrolidine-3,4-diol is NC1NC[C@H](O)[C@H]1O.
What is the InChIKey of (3S,4S)-2-aminopyrrolidine-3,4-diol?
The InChIKey is CUVIIWDDZNHFGS-URORKIPUSA-N. The full InChI is InChI=1S/C4H10N2O2/c5-4-3(8)2(7)1-6-4/h2-4,6-8H,1,5H2/t2-,3+,4?/m0/s1.
What are the key properties of (3S,4S)-2-aminopyrrolidine-3,4-diol?
(3S,4S)-2-aminopyrrolidine-3,4-diol has a molecular weight of 118.14 g/mol, XLogP of -2.40, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-2-aminopyrrolidine-3,4-diol is sourced from PubChem (CID 164682400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).