C25H21NO6 — CID 164682565
ethyl 1'-benzoyl-2',4-dioxospiro[3,5,6,7-tetrahydro-1-benzofuran-2,3'-indole]-3-carboxylate (PubChem CID 164682565) has the molecular formula C25H21NO6 and a molecular weight of 431.44 g/mol. Its IUPAC name is ethyl 1'-benzoyl-2',4-dioxospiro[3,5,6,7-tetrahydro-1-benzofuran-2,3'-indole]-3-carboxylate.
| Compound Name | ethyl 1'-benzoyl-2',4-dioxospiro[3,5,6,7-tetrahydro-1-benzofuran-2,3'-indole]-3-carboxylate |
|---|---|
| PubChem CID | 164682565 |
| Molecular Formula | C25H21NO6 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | ethyl 1'-benzoyl-2',4-dioxospiro[3,5,6,7-tetrahydro-1-benzofuran-2,3'-indole]-3-carboxylate |
| SMILES | CCOC(=O)C1C2=C(CCCC2=O)OC12C(=O)N(C(=O)c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C25H21NO6/c1-2-31-23(29)21-20-18(27)13-8-14-19(20)32-25(21)16-11-6-7-12-17(16)26(24(25)30)22(28)15-9-4-3-5-10-15/h3-7,9-12,21H,2,8,13-14H2,1H3 |
| InChIKey | ALEIOJVQYIXDFY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|