C18H19F7O4 — CID 164682767
diethyl 2-[3,4,4,4-tetrafluoro-1-phenyl-3-(trifluoromethyl)butyl]propanedioate (PubChem CID 164682767) has the molecular formula C18H19F7O4 and a molecular weight of 432.33 g/mol. Its IUPAC name is diethyl 2-[3,4,4,4-tetrafluoro-1-phenyl-3-(trifluoromethyl)butyl]propanedioate.
| Compound Name | diethyl 2-[3,4,4,4-tetrafluoro-1-phenyl-3-(trifluoromethyl)butyl]propanedioate |
|---|---|
| PubChem CID | 164682767 |
| Molecular Formula | C18H19F7O4 |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | diethyl 2-[3,4,4,4-tetrafluoro-1-phenyl-3-(trifluoromethyl)butyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(CC(F)(C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C18H19F7O4/c1-3-28-14(26)13(15(27)29-4-2)12(11-8-6-5-7-9-11)10-16(19,17(20,21)22)18(23,24)25/h5-9,12-13H,3-4,10H2,1-2H3 |
| InChIKey | OZPNLVNGFQOEQJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|