C21H19F11O4 — CID 164682768
diethyl 2-[1-phenyl-2-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethyl]propanedioate (PubChem CID 164682768) has the molecular formula C21H19F11O4 and a molecular weight of 544.36 g/mol. Its IUPAC name is diethyl 2-[1-phenyl-2-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethyl]propanedioate.
| Compound Name | diethyl 2-[1-phenyl-2-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethyl]propanedioate |
|---|---|
| PubChem CID | 164682768 |
| Molecular Formula | C21H19F11O4 |
| Molecular Weight | 544.36 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | diethyl 2-[1-phenyl-2-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(CC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F)c1ccccc1 |
| InChI | InChI=1S/C21H19F11O4/c1-3-35-14(33)13(15(34)36-4-2)12(11-8-6-5-7-9-11)10-16(22)17(23,24)19(27,28)21(31,32)20(29,30)18(16,25)26/h5-9,12-13H,3-4,10H2,1-2H3 |
| InChIKey | CLDZJQZBVAHJGI-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.36 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|