C20H26F3NO3 — CID 164682917
2,2,2-trifluoro-N-[(E,4S)-4-(3-formyl-4-methoxyphenyl)-4-methyloct-2-enyl]-N-methylacetamide (PubChem CID 164682917) has the molecular formula C20H26F3NO3 and a molecular weight of 385.43 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(E,4S)-4-(3-formyl-4-methoxyphenyl)-4-methyloct-2-enyl]-N-methylacetamide.
| Compound Name | 2,2,2-trifluoro-N-[(E,4S)-4-(3-formyl-4-methoxyphenyl)-4-methyloct-2-enyl]-N-methylacetamide |
|---|---|
| PubChem CID | 164682917 |
| Molecular Formula | C20H26F3NO3 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 2,2,2-trifluoro-N-[(E,4S)-4-(3-formyl-4-methoxyphenyl)-4-methyloct-2-enyl]-N-methylacetamide |
| SMILES | CCCC[C@@](C)(/C=C/CN(C)C(=O)C(F)(F)F)c1ccc(OC)c(C=O)c1 |
| InChI | InChI=1S/C20H26F3NO3/c1-5-6-10-19(2,11-7-12-24(3)18(26)20(21,22)23)16-8-9-17(27-4)15(13-16)14-25/h7-9,11,13-14H,5-6,10,12H2,1-4H3/b11-7+/t19-/m0/s1 |
| InChIKey | QXYQKKOCBAMFIR-SSVWKNEZSA-N |
| XLogP | 4.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|