C28H25NO3 — CID 164683005
(5R,6R,10S)-2-benzyl-10-hydroxy-6,9-diphenyl-2-azaspiro[4.5]dec-8-ene-3,4-dione (PubChem CID 164683005) has the molecular formula C28H25NO3 and a molecular weight of 423.51 g/mol. Its IUPAC name is (5R,6R,10S)-2-benzyl-10-hydroxy-6,9-diphenyl-2-azaspiro[4.5]dec-8-ene-3,4-dione.
| Compound Name | (5R,6R,10S)-2-benzyl-10-hydroxy-6,9-diphenyl-2-azaspiro[4.5]dec-8-ene-3,4-dione |
|---|---|
| PubChem CID | 164683005 |
| Molecular Formula | C28H25NO3 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | (5R,6R,10S)-2-benzyl-10-hydroxy-6,9-diphenyl-2-azaspiro[4.5]dec-8-ene-3,4-dione |
| SMILES | O=C1C(=O)[C@@]2(CN1Cc1ccccc1)[C@@H](c1ccccc1)CC=C(c1ccccc1)[C@@H]2O |
| InChI | InChI=1S/C28H25NO3/c30-25-23(21-12-6-2-7-13-21)16-17-24(22-14-8-3-9-15-22)28(25)19-29(27(32)26(28)31)18-20-10-4-1-5-11-20/h1-16,24-25,30H,17-19H2/t24-,25+,28+/m1/s1 |
| InChIKey | NHZDHEATKYEQDR-QQNWGBJXSA-N |
| XLogP | 4.22 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|