C32H27NO3 — CID 164683006
(1R,4S,5R)-7-benzyl-4-ethenyl-1-naphthalen-2-yl-4-phenyl-2-oxa-7-azaspiro[4.4]nonane-8,9-dione (PubChem CID 164683006) has the molecular formula C32H27NO3 and a molecular weight of 473.57 g/mol. Its IUPAC name is (1R,4S,5R)-7-benzyl-4-ethenyl-1-naphthalen-2-yl-4-phenyl-2-oxa-7-azaspiro[4.4]nonane-8,9-dione.
| Compound Name | (1R,4S,5R)-7-benzyl-4-ethenyl-1-naphthalen-2-yl-4-phenyl-2-oxa-7-azaspiro[4.4]nonane-8,9-dione |
|---|---|
| PubChem CID | 164683006 |
| Molecular Formula | C32H27NO3 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | (1R,4S,5R)-7-benzyl-4-ethenyl-1-naphthalen-2-yl-4-phenyl-2-oxa-7-azaspiro[4.4]nonane-8,9-dione |
| SMILES | C=C[C@@]1(c2ccccc2)CO[C@H](c2ccc3ccccc3c2)[C@]12CN(Cc1ccccc1)C(=O)C2=O |
| InChI | InChI=1S/C32H27NO3/c1-2-31(27-15-7-4-8-16-27)22-36-29(26-18-17-24-13-9-10-14-25(24)19-26)32(31)21-33(30(35)28(32)34)20-23-11-5-3-6-12-23/h2-19,29H,1,20-22H2/t29-,31+,32-/m1/s1 |
| InChIKey | DZROGHHMSJTRSI-YZRKUJAWSA-N |
| XLogP | 5.63 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|