C16H15NO — CID 164683017
(4R)-4-(furan-2-yl)-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 164683017) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is (4R)-4-(furan-2-yl)-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | (4R)-4-(furan-2-yl)-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 164683017 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (4R)-4-(furan-2-yl)-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | c1coc([C@@H]2CCCc3[nH]c4ccccc4c32)c1 |
| InChI | InChI=1S/C16H15NO/c1-2-7-13-11(5-1)16-12(15-9-4-10-18-15)6-3-8-14(16)17-13/h1-2,4-5,7,9-10,12,17H,3,6,8H2/t12-/m0/s1 |
| InChIKey | CBRCAOVZNXAMDI-LBPRGKRZSA-N |
| XLogP | 4.23 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|