C38H30N2O4S — CID 164683381
5-[3-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonylindol-2-yl]-6-phenylmethoxyquinoline (PubChem CID 164683381) has the molecular formula C38H30N2O4S and a molecular weight of 610.74 g/mol. Its IUPAC name is 5-[3-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonylindol-2-yl]-6-phenylmethoxyquinoline.
| Compound Name | 5-[3-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonylindol-2-yl]-6-phenylmethoxyquinoline |
|---|---|
| PubChem CID | 164683381 |
| Molecular Formula | C38H30N2O4S |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.19 |
| IUPAC Name | 5-[3-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonylindol-2-yl]-6-phenylmethoxyquinoline |
| SMILES | COc1ccc(-c2c(-c3c(OCc4ccccc4)ccc4ncccc34)n(S(=O)(=O)c3ccc(C)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C38H30N2O4S/c1-26-14-20-30(21-15-26)45(41,42)40-34-13-7-6-11-32(34)36(28-16-18-29(43-2)19-17-28)38(40)37-31-12-8-24-39-33(31)22-23-35(37)44-25-27-9-4-3-5-10-27/h3-24H,25H2,1-2H3 |
| InChIKey | REHSJIOUGNMVCY-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |