C12H14F9NO2 — CID 164683500
tert-butyl N-[(E)-4,4,5,5,6,6,7,7,7-nonafluorohept-2-enyl]carbamate (PubChem CID 164683500) has the molecular formula C12H14F9NO2 and a molecular weight of 375.23 g/mol. Its IUPAC name is tert-butyl N-[(E)-4,4,5,5,6,6,7,7,7-nonafluorohept-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4,4,5,5,6,6,7,7,7-nonafluorohept-2-enyl]carbamate |
|---|---|
| PubChem CID | 164683500 |
| Molecular Formula | C12H14F9NO2 |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | tert-butyl N-[(E)-4,4,5,5,6,6,7,7,7-nonafluorohept-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC/C=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H14F9NO2/c1-8(2,3)24-7(23)22-6-4-5-9(13,14)10(15,16)11(17,18)12(19,20)21/h4-5H,6H2,1-3H3,(H,22,23)/b5-4+ |
| InChIKey | OJCVINFPEFBBLW-SNAWJCMRSA-N |
| XLogP | 4.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|