About 2,6-dimethylhept-5-enyl diethyl phosphate
2,6-dimethylhept-5-enyl diethyl phosphate (PubChem CID 164683674) has the molecular formula C13H27O4P
and a molecular weight of 278.33 g/mol. Its IUPAC name is 2,6-dimethylhept-5-enyl diethyl phosphate.
Molecular Properties
| Compound Name | 2,6-dimethylhept-5-enyl diethyl phosphate |
| PubChem CID | 164683674 |
| Molecular Formula | C13H27O4P |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2,6-dimethylhept-5-enyl diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OCC(C)CCC=C(C)C |
| InChI | InChI=1S/C13H27O4P/c1-6-15-18(14,16-7-2)17-11-13(5)10-8-9-12(3)4/h9,13H,6-8,10-11H2,1-5H3 |
| InChIKey | QYMUYVCHIAMXCL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethylhept-5-enyl diethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylhept-5-enyl diethyl phosphate?
The IUPAC name of 2,6-dimethylhept-5-enyl diethyl phosphate (CID 164683674) is 2,6-dimethylhept-5-enyl diethyl phosphate.
What is the SMILES notation for 2,6-dimethylhept-5-enyl diethyl phosphate?
The canonical SMILES for 2,6-dimethylhept-5-enyl diethyl phosphate is CCOP(=O)(OCC)OCC(C)CCC=C(C)C.
What is the InChIKey of 2,6-dimethylhept-5-enyl diethyl phosphate?
The InChIKey is QYMUYVCHIAMXCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27O4P/c1-6-15-18(14,16-7-2)17-11-13(5)10-8-9-12(3)4/h9,13H,6-8,10-11H2,1-5H3.
What are the key properties of 2,6-dimethylhept-5-enyl diethyl phosphate?
2,6-dimethylhept-5-enyl diethyl phosphate has a molecular weight of 278.33 g/mol, XLogP of 4.57, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylhept-5-enyl diethyl phosphate is sourced from PubChem (CID 164683674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).