C15H29O2Si- — CID 164683732
3-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]cyclohexen-1-olate (PubChem CID 164683732) has the molecular formula C15H29O2Si- and a molecular weight of 269.48 g/mol. Its IUPAC name is 3-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]cyclohexen-1-olate.
| Compound Name | 3-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]cyclohexen-1-olate |
|---|---|
| PubChem CID | 164683732 |
| Molecular Formula | C15H29O2Si- |
| Molecular Weight | 269.48 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 3-[2-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]cyclohexen-1-olate |
| SMILES | CC(C)(O[Si](C)(C)C(C)(C)C)C1C=C([O-])CCC1 |
| InChI | InChI=1S/C15H30O2Si/c1-14(2,3)18(6,7)17-15(4,5)12-9-8-10-13(16)11-12/h11-12,16H,8-10H2,1-7H3/p-1 |
| InChIKey | RBHVZIXLDXRCSJ-UHFFFAOYSA-M |
| XLogP | 3.83 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|