C13H18O6 — CID 164683778
tert-butyl (3aR,4R,6aR)-4-ethyl-2,6-dioxo-3a,4-dihydro-3H-furo[2,3-c]furan-6a-carboxylate (PubChem CID 164683778) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is tert-butyl (3aR,4R,6aR)-4-ethyl-2,6-dioxo-3a,4-dihydro-3H-furo[2,3-c]furan-6a-carboxylate.
| Compound Name | tert-butyl (3aR,4R,6aR)-4-ethyl-2,6-dioxo-3a,4-dihydro-3H-furo[2,3-c]furan-6a-carboxylate |
|---|---|
| PubChem CID | 164683778 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | tert-butyl (3aR,4R,6aR)-4-ethyl-2,6-dioxo-3a,4-dihydro-3H-furo[2,3-c]furan-6a-carboxylate |
| SMILES | CC[C@H]1OC(=O)[C@]2(C(=O)OC(C)(C)C)OC(=O)C[C@H]12 |
| InChI | InChI=1S/C13H18O6/c1-5-8-7-6-9(14)18-13(7,10(15)17-8)11(16)19-12(2,3)4/h7-8H,5-6H2,1-4H3/t7-,8-,13-/m1/s1 |
| InChIKey | JPYUKEMNXVMAFY-OTPXZMOZSA-N |
| XLogP | 0.97 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|