About (3-fluoro-3-methylbutyl) naphthalene-2-carboxylate
(3-fluoro-3-methylbutyl) naphthalene-2-carboxylate (PubChem CID 164683806) has the molecular formula C16H17FO2
and a molecular weight of 260.31 g/mol. Its IUPAC name is (3-fluoro-3-methylbutyl) naphthalene-2-carboxylate.
Molecular Properties
| Compound Name | (3-fluoro-3-methylbutyl) naphthalene-2-carboxylate |
| PubChem CID | 164683806 |
| Molecular Formula | C16H17FO2 |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (3-fluoro-3-methylbutyl) naphthalene-2-carboxylate |
| SMILES | CC(C)(F)CCOC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H17FO2/c1-16(2,17)9-10-19-15(18)14-8-7-12-5-3-4-6-13(12)11-14/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | QLHSIDDVLSDOTH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-fluoro-3-methylbutyl) naphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluoro-3-methylbutyl) naphthalene-2-carboxylate?
The IUPAC name of (3-fluoro-3-methylbutyl) naphthalene-2-carboxylate (CID 164683806) is (3-fluoro-3-methylbutyl) naphthalene-2-carboxylate.
What is the SMILES notation for (3-fluoro-3-methylbutyl) naphthalene-2-carboxylate?
The canonical SMILES for (3-fluoro-3-methylbutyl) naphthalene-2-carboxylate is CC(C)(F)CCOC(=O)c1ccc2ccccc2c1.
What is the InChIKey of (3-fluoro-3-methylbutyl) naphthalene-2-carboxylate?
The InChIKey is QLHSIDDVLSDOTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FO2/c1-16(2,17)9-10-19-15(18)14-8-7-12-5-3-4-6-13(12)11-14/h3-8,11H,9-10H2,1-2H3.
What are the key properties of (3-fluoro-3-methylbutyl) naphthalene-2-carboxylate?
(3-fluoro-3-methylbutyl) naphthalene-2-carboxylate has a molecular weight of 260.31 g/mol, XLogP of 4.13, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluoro-3-methylbutyl) naphthalene-2-carboxylate is sourced from PubChem (CID 164683806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).