C15H32OSi — CID 164683902
tert-butyl-[(1R,2R)-2-butylcyclopentyl]oxy-dimethylsilane (PubChem CID 164683902) has the molecular formula C15H32OSi and a molecular weight of 256.51 g/mol. Its IUPAC name is tert-butyl-[(1R,2R)-2-butylcyclopentyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2R)-2-butylcyclopentyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 164683902 |
| Molecular Formula | C15H32OSi |
| Molecular Weight | 256.51 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | tert-butyl-[(1R,2R)-2-butylcyclopentyl]oxy-dimethylsilane |
| SMILES | CCCC[C@@H]1CCC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32OSi/c1-7-8-10-13-11-9-12-14(13)16-17(5,6)15(2,3)4/h13-14H,7-12H2,1-6H3/t13-,14-/m1/s1 |
| InChIKey | YHATYQBUTMEIGB-ZIAGYGMSSA-N |
| XLogP | 5.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.51 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|