C28H35F3O2Si — CID 164684082
tert-butyl-[(2S,4S)-2,4-dimethyl-5-[5-(trifluoromethyl)furan-2-yl]pentoxy]-diphenylsilane (PubChem CID 164684082) has the molecular formula C28H35F3O2Si and a molecular weight of 488.67 g/mol. Its IUPAC name is tert-butyl-[(2S,4S)-2,4-dimethyl-5-[5-(trifluoromethyl)furan-2-yl]pentoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S,4S)-2,4-dimethyl-5-[5-(trifluoromethyl)furan-2-yl]pentoxy]-diphenylsilane |
|---|---|
| PubChem CID | 164684082 |
| Molecular Formula | C28H35F3O2Si |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | tert-butyl-[(2S,4S)-2,4-dimethyl-5-[5-(trifluoromethyl)furan-2-yl]pentoxy]-diphenylsilane |
| SMILES | C[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@H](C)Cc1ccc(C(F)(F)F)o1 |
| InChI | InChI=1S/C28H35F3O2Si/c1-21(19-23-16-17-26(33-23)28(29,30)31)18-22(2)20-32-34(27(3,4)5,24-12-8-6-9-13-24)25-14-10-7-11-15-25/h6-17,21-22H,18-20H2,1-5H3/t21-,22-/m0/s1 |
| InChIKey | YDJGLRSXAFUJJM-VXKWHMMOSA-N |
| XLogP | 7.08 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|