C13H21NO — CID 164684528
(1R,3aS,6aR)-6-ethyl-6a-hydroxy-3,3-dimethyl-1,2,3a,4,5,6-hexahydropentalene-1-carbonitrile (PubChem CID 164684528) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (1R,3aS,6aR)-6-ethyl-6a-hydroxy-3,3-dimethyl-1,2,3a,4,5,6-hexahydropentalene-1-carbonitrile.
| Compound Name | (1R,3aS,6aR)-6-ethyl-6a-hydroxy-3,3-dimethyl-1,2,3a,4,5,6-hexahydropentalene-1-carbonitrile |
|---|---|
| PubChem CID | 164684528 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (1R,3aS,6aR)-6-ethyl-6a-hydroxy-3,3-dimethyl-1,2,3a,4,5,6-hexahydropentalene-1-carbonitrile |
| SMILES | CCC1CC[C@H]2C(C)(C)C[C@H](C#N)[C@@]12O |
| InChI | InChI=1S/C13H21NO/c1-4-9-5-6-11-12(2,3)7-10(8-14)13(9,11)15/h9-11,15H,4-7H2,1-3H3/t9?,10-,11+,13+/m1/s1 |
| InChIKey | GDELPVROVDNIPS-MPNXRLBESA-N |
| XLogP | 2.72 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |