About 4-O-ethyl 1-O-methyl (2R)-3-diazo-2-hydroxy-2-phenylbutanedioate
4-O-ethyl 1-O-methyl (2R)-3-diazo-2-hydroxy-2-phenylbutanedioate (PubChem CID 164684741) has the molecular formula C13H14N2O5
and a molecular weight of 278.26 g/mol. Its IUPAC name is 4-O-ethyl 1-O-methyl (2R)-3-diazo-2-hydroxy-2-phenylbutanedioate.
Molecular Properties
| Compound Name | 4-O-ethyl 1-O-methyl (2R)-3-diazo-2-hydroxy-2-phenylbutanedioate |
| PubChem CID | 164684741 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 4-O-ethyl 1-O-methyl (2R)-3-diazo-2-hydroxy-2-phenylbutanedioate |
| SMILES | CCOC(=O)C(=[N+]=[N-])[C@@](O)(C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C13H14N2O5/c1-3-20-11(16)10(15-14)13(18,12(17)19-2)9-7-5-4-6-8-9/h4-8,18H,3H2,1-2H3/t13-/m1/s1 |
| InChIKey | POZBPLSKSKGYQY-CYBMUJFWSA-N |
| XLogP | 0.28 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-O-ethyl 1-O-methyl (2R)-3-diazo-2-hydroxy-2-phenylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-ethyl 1-O-methyl (2R)-3-diazo-2-hydroxy-2-phenylbutanedioate?
The IUPAC name of 4-O-ethyl 1-O-methyl (2R)-3-diazo-2-hydroxy-2-phenylbutanedioate (CID 164684741) is 4-O-ethyl 1-O-methyl (2R)-3-diazo-2-hydroxy-2-phenylbutanedioate.
What is the SMILES notation for 4-O-ethyl 1-O-methyl (2R)-3-diazo-2-hydroxy-2-phenylbutanedioate?
The canonical SMILES for 4-O-ethyl 1-O-methyl (2R)-3-diazo-2-hydroxy-2-phenylbutanedioate is CCOC(=O)C(=[N+]=[N-])[C@@](O)(C(=O)OC)c1ccccc1.
What is the InChIKey of 4-O-ethyl 1-O-methyl (2R)-3-diazo-2-hydroxy-2-phenylbutanedioate?
The InChIKey is POZBPLSKSKGYQY-CYBMUJFWSA-N. The full InChI is InChI=1S/C13H14N2O5/c1-3-20-11(16)10(15-14)13(18,12(17)19-2)9-7-5-4-6-8-9/h4-8,18H,3H2,1-2H3/t13-/m1/s1.
What are the key properties of 4-O-ethyl 1-O-methyl (2R)-3-diazo-2-hydroxy-2-phenylbutanedioate?
4-O-ethyl 1-O-methyl (2R)-3-diazo-2-hydroxy-2-phenylbutanedioate has a molecular weight of 278.26 g/mol, XLogP of 0.28, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-ethyl 1-O-methyl (2R)-3-diazo-2-hydroxy-2-phenylbutanedioate is sourced from PubChem (CID 164684741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).