C41H43NP2 — CID 164684801
N-[[(2R,5R)-2,5-diphenylphospholan-1-yl]methyl]-N-[[(2S,5S)-2,5-diphenylphospholan-1-yl]methyl]-1-phenylmethanamine (PubChem CID 164684801) has the molecular formula C41H43NP2 and a molecular weight of 611.75 g/mol. Its IUPAC name is N-[[(2R,5R)-2,5-diphenylphospholan-1-yl]methyl]-N-[[(2S,5S)-2,5-diphenylphospholan-1-yl]methyl]-1-phenylmethanamine.
| Compound Name | N-[[(2R,5R)-2,5-diphenylphospholan-1-yl]methyl]-N-[[(2S,5S)-2,5-diphenylphospholan-1-yl]methyl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 164684801 |
| Molecular Formula | C41H43NP2 |
| Molecular Weight | 611.75 g/mol |
| Exact Mass | 611.29 |
| IUPAC Name | N-[[(2R,5R)-2,5-diphenylphospholan-1-yl]methyl]-N-[[(2S,5S)-2,5-diphenylphospholan-1-yl]methyl]-1-phenylmethanamine |
| SMILES | c1ccc(CN(CP2[C@@H](c3ccccc3)CC[C@@H]2c2ccccc2)CP2[C@H](c3ccccc3)CC[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C41H43NP2/c1-6-16-33(17-7-1)30-42(31-43-38(34-18-8-2-9-19-34)26-27-39(43)35-20-10-3-11-21-35)32-44-40(36-22-12-4-13-23-36)28-29-41(44)37-24-14-5-15-25-37/h1-25,38-41H,26-32H2/t38-,39-,40+,41+ |
| InChIKey | LFSISURFXBKCIY-UHPHPOBLSA-N |
| XLogP | 11.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.75 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|