C13H19F9O — CID 164684948
1,1,1,2,2,3,3,4,4-nonafluoro-6-methyldodecan-6-ol (PubChem CID 164684948) has the molecular formula C13H19F9O and a molecular weight of 362.28 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluoro-6-methyldodecan-6-ol.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluoro-6-methyldodecan-6-ol |
|---|---|
| PubChem CID | 164684948 |
| Molecular Formula | C13H19F9O |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluoro-6-methyldodecan-6-ol |
| SMILES | CCCCCCC(C)(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H19F9O/c1-3-4-5-6-7-9(2,23)8-10(14,15)11(16,17)12(18,19)13(20,21)22/h23H,3-8H2,1-2H3 |
| InChIKey | WFYQRTTZXHEARP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|