C24H23NO — CID 164684988
(1R,2R)-2-(1H-indol-3-yl)-1,2-bis(4-methylphenyl)ethanol (PubChem CID 164684988) has the molecular formula C24H23NO and a molecular weight of 341.45 g/mol. Its IUPAC name is (1R,2R)-2-(1H-indol-3-yl)-1,2-bis(4-methylphenyl)ethanol.
| Compound Name | (1R,2R)-2-(1H-indol-3-yl)-1,2-bis(4-methylphenyl)ethanol |
|---|---|
| PubChem CID | 164684988 |
| Molecular Formula | C24H23NO |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | (1R,2R)-2-(1H-indol-3-yl)-1,2-bis(4-methylphenyl)ethanol |
| SMILES | Cc1ccc([C@H](c2c[nH]c3ccccc23)[C@@H](O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H23NO/c1-16-7-11-18(12-8-16)23(24(26)19-13-9-17(2)10-14-19)21-15-25-22-6-4-3-5-20(21)22/h3-15,23-26H,1-2H3/t23-,24+/m1/s1 |
| InChIKey | CVDYZAQYXIKTCT-RPWUZVMVSA-N |
| XLogP | 5.65 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |