About [(2R)-1-cyclopropyl-2,5-diphenyl-2,3-dihydropyrrol-4-yl]-phenylmethanone
[(2R)-1-cyclopropyl-2,5-diphenyl-2,3-dihydropyrrol-4-yl]-phenylmethanone (PubChem CID 164685207) has the molecular formula C26H23NO
and a molecular weight of 365.48 g/mol. Its IUPAC name is [(2R)-1-cyclopropyl-2,5-diphenyl-2,3-dihydropyrrol-4-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [(2R)-1-cyclopropyl-2,5-diphenyl-2,3-dihydropyrrol-4-yl]-phenylmethanone |
| PubChem CID | 164685207 |
| Molecular Formula | C26H23NO |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | [(2R)-1-cyclopropyl-2,5-diphenyl-2,3-dihydropyrrol-4-yl]-phenylmethanone |
| SMILES | O=C(C1=C(c2ccccc2)N(C2CC2)[C@@H](c2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C26H23NO/c28-26(21-14-8-3-9-15-21)23-18-24(19-10-4-1-5-11-19)27(22-16-17-22)25(23)20-12-6-2-7-13-20/h1-15,22,24H,16-18H2/t24-/m1/s1 |
| InChIKey | ZMZAOXAFCINBSM-XMMPIXPASA-N |
| XLogP | 5.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2R)-1-cyclopropyl-2,5-diphenyl-2,3-dihydropyrrol-4-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-cyclopropyl-2,5-diphenyl-2,3-dihydropyrrol-4-yl]-phenylmethanone?
The IUPAC name of [(2R)-1-cyclopropyl-2,5-diphenyl-2,3-dihydropyrrol-4-yl]-phenylmethanone (CID 164685207) is [(2R)-1-cyclopropyl-2,5-diphenyl-2,3-dihydropyrrol-4-yl]-phenylmethanone.
What is the SMILES notation for [(2R)-1-cyclopropyl-2,5-diphenyl-2,3-dihydropyrrol-4-yl]-phenylmethanone?
The canonical SMILES for [(2R)-1-cyclopropyl-2,5-diphenyl-2,3-dihydropyrrol-4-yl]-phenylmethanone is O=C(C1=C(c2ccccc2)N(C2CC2)[C@@H](c2ccccc2)C1)c1ccccc1.
What is the InChIKey of [(2R)-1-cyclopropyl-2,5-diphenyl-2,3-dihydropyrrol-4-yl]-phenylmethanone?
The InChIKey is ZMZAOXAFCINBSM-XMMPIXPASA-N. The full InChI is InChI=1S/C26H23NO/c28-26(21-14-8-3-9-15-21)23-18-24(19-10-4-1-5-11-19)27(22-16-17-22)25(23)20-12-6-2-7-13-20/h1-15,22,24H,16-18H2/t24-/m1/s1.
What are the key properties of [(2R)-1-cyclopropyl-2,5-diphenyl-2,3-dihydropyrrol-4-yl]-phenylmethanone?
[(2R)-1-cyclopropyl-2,5-diphenyl-2,3-dihydropyrrol-4-yl]-phenylmethanone has a molecular weight of 365.48 g/mol, XLogP of 5.89, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-cyclopropyl-2,5-diphenyl-2,3-dihydropyrrol-4-yl]-phenylmethanone is sourced from PubChem (CID 164685207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).