About zinc;carbanide;diethyl 2-tert-butylbut-2-enedioate
zinc;carbanide;diethyl 2-tert-butylbut-2-enedioate (PubChem CID 164685477) has the molecular formula C13H22O4Zn
and a molecular weight of 307.71 g/mol. Its IUPAC name is zinc;carbanide;diethyl 2-tert-butylbut-2-enedioate.
Molecular Properties
| Compound Name | zinc;carbanide;diethyl 2-tert-butylbut-2-enedioate |
| PubChem CID | 164685477 |
| Molecular Formula | C13H22O4Zn |
| Molecular Weight | 307.71 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | zinc;carbanide;diethyl 2-tert-butylbut-2-enedioate |
| SMILES | CCOC(=O)/[C-]=C(\C(=O)OCC)C(C)(C)C.[CH3-].[Zn+2] |
| InChI | InChI=1S/C12H19O4.CH3.Zn/c1-6-15-10(13)8-9(12(3,4)5)11(14)16-7-2;;/h6-7H2,1-5H3;1H3;/q2*-1;+2 |
| InChIKey | QPEPAPFXUSDMIM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.71 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze zinc;carbanide;diethyl 2-tert-butylbut-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;carbanide;diethyl 2-tert-butylbut-2-enedioate?
The IUPAC name of zinc;carbanide;diethyl 2-tert-butylbut-2-enedioate (CID 164685477) is zinc;carbanide;diethyl 2-tert-butylbut-2-enedioate.
What is the SMILES notation for zinc;carbanide;diethyl 2-tert-butylbut-2-enedioate?
The canonical SMILES for zinc;carbanide;diethyl 2-tert-butylbut-2-enedioate is CCOC(=O)/[C-]=C(\C(=O)OCC)C(C)(C)C.[CH3-].[Zn+2].
What is the InChIKey of zinc;carbanide;diethyl 2-tert-butylbut-2-enedioate?
The InChIKey is QPEPAPFXUSDMIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19O4.CH3.Zn/c1-6-15-10(13)8-9(12(3,4)5)11(14)16-7-2;;/h6-7H2,1-5H3;1H3;/q2*-1;+2.
What are the key properties of zinc;carbanide;diethyl 2-tert-butylbut-2-enedioate?
zinc;carbanide;diethyl 2-tert-butylbut-2-enedioate has a molecular weight of 307.71 g/mol, XLogP of 2.34, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;carbanide;diethyl 2-tert-butylbut-2-enedioate is sourced from PubChem (CID 164685477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).