About 3-benzoyl-6,8-ditert-butyl-4-[(E)-2-phenylethenyl]chromen-2-one
3-benzoyl-6,8-ditert-butyl-4-[(E)-2-phenylethenyl]chromen-2-one (PubChem CID 164685560) has the molecular formula C32H32O3
and a molecular weight of 464.61 g/mol. Its IUPAC name is 3-benzoyl-6,8-ditert-butyl-4-[(E)-2-phenylethenyl]chromen-2-one.
Molecular Properties
| Compound Name | 3-benzoyl-6,8-ditert-butyl-4-[(E)-2-phenylethenyl]chromen-2-one |
| PubChem CID | 164685560 |
| Molecular Formula | C32H32O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 3-benzoyl-6,8-ditert-butyl-4-[(E)-2-phenylethenyl]chromen-2-one |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2oc(=O)c(C(=O)c3ccccc3)c(/C=C/c3ccccc3)c2c1 |
| InChI | InChI=1S/C32H32O3/c1-31(2,3)23-19-25-24(18-17-21-13-9-7-10-14-21)27(28(33)22-15-11-8-12-16-22)30(34)35-29(25)26(20-23)32(4,5)6/h7-20H,1-6H3/b18-17+ |
| InChIKey | UBUGYHBMWIVHEN-ISLYRVAYSA-N |
| XLogP | 7.79 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-benzoyl-6,8-ditert-butyl-4-[(E)-2-phenylethenyl]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzoyl-6,8-ditert-butyl-4-[(E)-2-phenylethenyl]chromen-2-one?
The IUPAC name of 3-benzoyl-6,8-ditert-butyl-4-[(E)-2-phenylethenyl]chromen-2-one (CID 164685560) is 3-benzoyl-6,8-ditert-butyl-4-[(E)-2-phenylethenyl]chromen-2-one.
What is the SMILES notation for 3-benzoyl-6,8-ditert-butyl-4-[(E)-2-phenylethenyl]chromen-2-one?
The canonical SMILES for 3-benzoyl-6,8-ditert-butyl-4-[(E)-2-phenylethenyl]chromen-2-one is CC(C)(C)c1cc(C(C)(C)C)c2oc(=O)c(C(=O)c3ccccc3)c(/C=C/c3ccccc3)c2c1.
What is the InChIKey of 3-benzoyl-6,8-ditert-butyl-4-[(E)-2-phenylethenyl]chromen-2-one?
The InChIKey is UBUGYHBMWIVHEN-ISLYRVAYSA-N. The full InChI is InChI=1S/C32H32O3/c1-31(2,3)23-19-25-24(18-17-21-13-9-7-10-14-21)27(28(33)22-15-11-8-12-16-22)30(34)35-29(25)26(20-23)32(4,5)6/h7-20H,1-6H3/b18-17+.
What are the key properties of 3-benzoyl-6,8-ditert-butyl-4-[(E)-2-phenylethenyl]chromen-2-one?
3-benzoyl-6,8-ditert-butyl-4-[(E)-2-phenylethenyl]chromen-2-one has a molecular weight of 464.61 g/mol, XLogP of 7.79, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzoyl-6,8-ditert-butyl-4-[(E)-2-phenylethenyl]chromen-2-one is sourced from PubChem (CID 164685560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).