C45H47N2O2S2+ — CID 164685582
(4Z)-4-[(2E,4E)-5-[6-(diethylamino)-2-(4-methoxyphenyl)thiochromenylium-4-yl]penta-2,4-dienylidene]-N,N-diethyl-2-(4-methoxyphenyl)thiochromen-6-amine (PubChem CID 164685582) has the molecular formula C45H47N2O2S2+ and a molecular weight of 712.02 g/mol. Its IUPAC name is (4Z)-4-[(2E,4E)-5-[6-(diethylamino)-2-(4-methoxyphenyl)thiochromenylium-4-yl]penta-2,4-dienylidene]-N,N-diethyl-2-(4-methoxyphenyl)thiochromen-6-amine.
| Compound Name | (4Z)-4-[(2E,4E)-5-[6-(diethylamino)-2-(4-methoxyphenyl)thiochromenylium-4-yl]penta-2,4-dienylidene]-N,N-diethyl-2-(4-methoxyphenyl)thiochromen-6-amine |
|---|---|
| PubChem CID | 164685582 |
| Molecular Formula | C45H47N2O2S2+ |
| Molecular Weight | 712.02 g/mol |
| Exact Mass | 711.31 |
| IUPAC Name | (4Z)-4-[(2E,4E)-5-[6-(diethylamino)-2-(4-methoxyphenyl)thiochromenylium-4-yl]penta-2,4-dienylidene]-N,N-diethyl-2-(4-methoxyphenyl)thiochromen-6-amine |
| SMILES | CCN(CC)c1ccc2c(c1)/C(=C\C=C\C=C\c1cc(-c3ccc(OC)cc3)[s+]c3ccc(N(CC)CC)cc13)C=C(c1ccc(OC)cc1)S2 |
| InChI | InChI=1S/C45H47N2O2S2/c1-7-46(8-2)36-20-26-42-40(30-36)34(28-44(50-42)32-16-22-38(48-5)23-17-32)14-12-11-13-15-35-29-45(33-18-24-39(49-6)25-19-33)51-43-27-21-37(31-41(35)43)47(9-3)10-4/h11-31H,7-10H2,1-6H3/q+1 |
| InChIKey | XUHTXNDLOHWDBP-UHFFFAOYSA-N |
| XLogP | 12.36 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.02 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|