C25H21NO2 — CID 164685894
5-[4-(dimethylamino)phenyl]-3,6-diphenylpyran-2-one (PubChem CID 164685894) has the molecular formula C25H21NO2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 5-[4-(dimethylamino)phenyl]-3,6-diphenylpyran-2-one.
| Compound Name | 5-[4-(dimethylamino)phenyl]-3,6-diphenylpyran-2-one |
|---|---|
| PubChem CID | 164685894 |
| Molecular Formula | C25H21NO2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 5-[4-(dimethylamino)phenyl]-3,6-diphenylpyran-2-one |
| SMILES | CN(C)c1ccc(-c2cc(-c3ccccc3)c(=O)oc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21NO2/c1-26(2)21-15-13-19(14-16-21)22-17-23(18-9-5-3-6-10-18)25(27)28-24(22)20-11-7-4-8-12-20/h3-17H,1-2H3 |
| InChIKey | QOTKCQJVBRYSRL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |