C29H54O4SiSn — CID 164686402
dimethyl (3Z,4Z)-3-[[tert-butyl(dimethyl)silyl]methylidene]-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 164686402) has the molecular formula C29H54O4SiSn and a molecular weight of 613.54 g/mol. Its IUPAC name is dimethyl (3Z,4Z)-3-[[tert-butyl(dimethyl)silyl]methylidene]-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (3Z,4Z)-3-[[tert-butyl(dimethyl)silyl]methylidene]-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 164686402 |
| Molecular Formula | C29H54O4SiSn |
| Molecular Weight | 613.54 g/mol |
| Exact Mass | 614.28 |
| IUPAC Name | dimethyl (3Z,4Z)-3-[[tert-butyl(dimethyl)silyl]methylidene]-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | CCCC[Sn](/C=C1/CC(C(=O)OC)(C(=O)OC)C/C1=C/[Si](C)(C)C(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C17H27O4Si.3C4H9.Sn/c1-12-9-17(14(18)20-5,15(19)21-6)10-13(12)11-22(7,8)16(2,3)4;3*1-3-4-2;/h1,11H,9-10H2,2-8H3;3*1,3-4H2,2H3;/b12-1?,13-11-;;;; |
| InChIKey | ZFHQVJFMCRGQNS-LXRDSBTASA-N |
| XLogP | 8.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.54 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|