C22H17NO2S — CID 164686583
5-methyl-2-phenyl-2-thiophen-2-yl-3H-furo[3,2-c]quinolin-4-one (PubChem CID 164686583) has the molecular formula C22H17NO2S and a molecular weight of 359.45 g/mol. Its IUPAC name is 5-methyl-2-phenyl-2-thiophen-2-yl-3H-furo[3,2-c]quinolin-4-one.
| Compound Name | 5-methyl-2-phenyl-2-thiophen-2-yl-3H-furo[3,2-c]quinolin-4-one |
|---|---|
| PubChem CID | 164686583 |
| Molecular Formula | C22H17NO2S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 5-methyl-2-phenyl-2-thiophen-2-yl-3H-furo[3,2-c]quinolin-4-one |
| SMILES | Cn1c(=O)c2c(c3ccccc31)OC(c1ccccc1)(c1cccs1)C2 |
| InChI | InChI=1S/C22H17NO2S/c1-23-18-11-6-5-10-16(18)20-17(21(23)24)14-22(25-20,19-12-7-13-26-19)15-8-3-2-4-9-15/h2-13H,14H2,1H3 |
| InChIKey | JFZDPZPPPALHBK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |