C28H22F9NO2 — CID 164686619
4-[(1S)-3,3,4,4,5,5,6,6,6-nonafluoro-1-(5-methoxy-1H-indol-3-yl)-1-(4-methylphenyl)hexyl]phenol (PubChem CID 164686619) has the molecular formula C28H22F9NO2 and a molecular weight of 575.47 g/mol. Its IUPAC name is 4-[(1S)-3,3,4,4,5,5,6,6,6-nonafluoro-1-(5-methoxy-1H-indol-3-yl)-1-(4-methylphenyl)hexyl]phenol.
| Compound Name | 4-[(1S)-3,3,4,4,5,5,6,6,6-nonafluoro-1-(5-methoxy-1H-indol-3-yl)-1-(4-methylphenyl)hexyl]phenol |
|---|---|
| PubChem CID | 164686619 |
| Molecular Formula | C28H22F9NO2 |
| Molecular Weight | 575.47 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | 4-[(1S)-3,3,4,4,5,5,6,6,6-nonafluoro-1-(5-methoxy-1H-indol-3-yl)-1-(4-methylphenyl)hexyl]phenol |
| SMILES | COc1ccc2[nH]cc([C@@](CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c3ccc(C)cc3)c3ccc(O)cc3)c2c1 |
| InChI | InChI=1S/C28H22F9NO2/c1-16-3-5-17(6-4-16)24(18-7-9-19(39)10-8-18,22-14-38-23-12-11-20(40-2)13-21(22)23)15-25(29,30)26(31,32)27(33,34)28(35,36)37/h3-14,38-39H,15H2,1-2H3/t24-/m0/s1 |
| InChIKey | WCTHWIMBSSJLMY-DEOSSOPVSA-N |
| XLogP | 8.38 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.47 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|