C28H29GeNO2 — CID 164686909
4,4-dimethyl-3-[(1E)-1-triphenylgermylpenta-1,4-dien-2-yl]-1,3-oxazolidin-2-one (PubChem CID 164686909) has the molecular formula C28H29GeNO2 and a molecular weight of 484.16 g/mol. Its IUPAC name is 4,4-dimethyl-3-[(1E)-1-triphenylgermylpenta-1,4-dien-2-yl]-1,3-oxazolidin-2-one.
| Compound Name | 4,4-dimethyl-3-[(1E)-1-triphenylgermylpenta-1,4-dien-2-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 164686909 |
| Molecular Formula | C28H29GeNO2 |
| Molecular Weight | 484.16 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 4,4-dimethyl-3-[(1E)-1-triphenylgermylpenta-1,4-dien-2-yl]-1,3-oxazolidin-2-one |
| SMILES | C=CC/C(=C\[Ge](c1ccccc1)(c1ccccc1)c1ccccc1)N1C(=O)OCC1(C)C |
| InChI | InChI=1S/C28H29GeNO2/c1-4-14-26(30-27(31)32-22-28(30,2)3)21-29(23-15-8-5-9-16-23,24-17-10-6-11-18-24)25-19-12-7-13-20-25/h4-13,15-21H,1,14,22H2,2-3H3/b26-21+ |
| InChIKey | GRXXYLPZQSQMRF-YYADALCUSA-N |
| XLogP | 4.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.16 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|