About zinc;4,4-dimethyl-3-(2-triphenylgermylethenyl)-1,3-oxazolidin-2-one;ethane
zinc;4,4-dimethyl-3-(2-triphenylgermylethenyl)-1,3-oxazolidin-2-one;ethane (PubChem CID 164686910) has the molecular formula C27H29GeNO2Zn
and a molecular weight of 537.53 g/mol. Its IUPAC name is zinc;4,4-dimethyl-3-(2-triphenylgermylethenyl)-1,3-oxazolidin-2-one;ethane.
Molecular Properties
| Compound Name | zinc;4,4-dimethyl-3-(2-triphenylgermylethenyl)-1,3-oxazolidin-2-one;ethane |
| PubChem CID | 164686910 |
| Molecular Formula | C27H29GeNO2Zn |
| Molecular Weight | 537.53 g/mol |
| Exact Mass | 537.07 |
| IUPAC Name | zinc;4,4-dimethyl-3-(2-triphenylgermylethenyl)-1,3-oxazolidin-2-one;ethane |
| SMILES | CC1(C)COC(=O)N1/[C-]=C/[Ge](c1ccccc1)(c1ccccc1)c1ccccc1.[CH2-]C.[Zn+2] |
| InChI | InChI=1S/C25H24GeNO2.C2H5.Zn/c1-25(2)20-29-24(28)27(25)19-18-26(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23;1-2;/h3-18H,20H2,1-2H3;1H2,2H3;/q2*-1;+2 |
| InChIKey | PBVVTLNTCXFYHW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 537.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;4,4-dimethyl-3-(2-triphenylgermylethenyl)-1,3-oxazolidin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;4,4-dimethyl-3-(2-triphenylgermylethenyl)-1,3-oxazolidin-2-one;ethane?
The IUPAC name of zinc;4,4-dimethyl-3-(2-triphenylgermylethenyl)-1,3-oxazolidin-2-one;ethane (CID 164686910) is zinc;4,4-dimethyl-3-(2-triphenylgermylethenyl)-1,3-oxazolidin-2-one;ethane.
What is the SMILES notation for zinc;4,4-dimethyl-3-(2-triphenylgermylethenyl)-1,3-oxazolidin-2-one;ethane?
The canonical SMILES for zinc;4,4-dimethyl-3-(2-triphenylgermylethenyl)-1,3-oxazolidin-2-one;ethane is CC1(C)COC(=O)N1/[C-]=C/[Ge](c1ccccc1)(c1ccccc1)c1ccccc1.[CH2-]C.[Zn+2].
What is the InChIKey of zinc;4,4-dimethyl-3-(2-triphenylgermylethenyl)-1,3-oxazolidin-2-one;ethane?
The InChIKey is PBVVTLNTCXFYHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24GeNO2.C2H5.Zn/c1-25(2)20-29-24(28)27(25)19-18-26(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23;1-2;/h3-18H,20H2,1-2H3;1H2,2H3;/q2*-1;+2.
What are the key properties of zinc;4,4-dimethyl-3-(2-triphenylgermylethenyl)-1,3-oxazolidin-2-one;ethane?
zinc;4,4-dimethyl-3-(2-triphenylgermylethenyl)-1,3-oxazolidin-2-one;ethane has a molecular weight of 537.53 g/mol, XLogP of 4.08, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;4,4-dimethyl-3-(2-triphenylgermylethenyl)-1,3-oxazolidin-2-one;ethane is sourced from PubChem (CID 164686910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).