C39H33GeNO2 — CID 164686912
3-[(E)-1,4-diphenyl-1-triphenylgermylbut-1-en-3-yn-2-yl]-4,4-dimethyl-1,3-oxazolidin-2-one (PubChem CID 164686912) has the molecular formula C39H33GeNO2 and a molecular weight of 620.31 g/mol. Its IUPAC name is 3-[(E)-1,4-diphenyl-1-triphenylgermylbut-1-en-3-yn-2-yl]-4,4-dimethyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[(E)-1,4-diphenyl-1-triphenylgermylbut-1-en-3-yn-2-yl]-4,4-dimethyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 164686912 |
| Molecular Formula | C39H33GeNO2 |
| Molecular Weight | 620.31 g/mol |
| Exact Mass | 621.17 |
| IUPAC Name | 3-[(E)-1,4-diphenyl-1-triphenylgermylbut-1-en-3-yn-2-yl]-4,4-dimethyl-1,3-oxazolidin-2-one |
| SMILES | CC1(C)COC(=O)N1/C(C#Cc1ccccc1)=C(\c1ccccc1)[Ge](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H33GeNO2/c1-39(2)30-43-38(42)41(39)36(29-28-31-18-8-3-9-19-31)37(32-20-10-4-11-21-32)40(33-22-12-5-13-23-33,34-24-14-6-15-25-34)35-26-16-7-17-27-35/h3-27H,30H2,1-2H3/b37-36+ |
| InChIKey | HGLULPSKTQCBOO-BSRQYYOTSA-N |
| XLogP | 6.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.31 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|