About CID 164687050
CID 164687050 (PubChem CID 164687050) has the molecular formula C28H84Si14Sn2
and a molecular weight of 1051.61 g/mol.
Molecular Properties
| Compound Name | CID 164687050 |
| PubChem CID | 164687050 |
| Molecular Formula | C28H84Si14Sn2 |
| Molecular Weight | 1051.61 g/mol |
| Exact Mass | 1052.14 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)C.C[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)C.[Sn]=[Sn] |
| InChI | InChI=1S/2C14H42Si7.2Sn/c2*1-17(2,3)15(18(4,5)6)21(13,14)16(19(7,8)9)20(10,11)12;;/h2*1-14H3;; |
| InChIKey | HVWMUSGQOYXDON-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1051.61 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 164687050 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164687050?
The IUPAC name of CID 164687050 (CID 164687050) is not available.
What is the SMILES notation for CID 164687050?
The canonical SMILES for CID 164687050 is C[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)C.C[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)[Si]([Si](C)(C)C)[Si](C)(C)C.[Sn]=[Sn].
What is the InChIKey of CID 164687050?
The InChIKey is HVWMUSGQOYXDON-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H42Si7.2Sn/c2*1-17(2,3)15(18(4,5)6)21(13,14)16(19(7,8)9)20(10,11)12;;/h2*1-14H3;;.
What are the key properties of CID 164687050?
CID 164687050 has a molecular weight of 1051.61 g/mol, XLogP of 10.25, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164687050 is sourced from PubChem (CID 164687050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).