C18H19OP — CID 164687316
[3-methylpenta-1,2-dienyl(phenyl)phosphoryl]benzene (PubChem CID 164687316) has the molecular formula C18H19OP and a molecular weight of 282.32 g/mol. Its IUPAC name is [3-methylpenta-1,2-dienyl(phenyl)phosphoryl]benzene.
| Compound Name | [3-methylpenta-1,2-dienyl(phenyl)phosphoryl]benzene |
|---|---|
| PubChem CID | 164687316 |
| Molecular Formula | C18H19OP |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | [3-methylpenta-1,2-dienyl(phenyl)phosphoryl]benzene |
| SMILES | CCC(C)=C=CP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19OP/c1-3-16(2)14-15-20(19,17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,15H,3H2,1-2H3 |
| InChIKey | WWGYMWUXHRIMII-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|