C29H36N6O4S — CID 164687807
1-[15-(2-ethoxyacetyl)-18-oxa-3,6,10,15-tetrazatricyclo[17.3.1.02,6]tricosa-1(23),2,4,19,21-pentaen-10-yl]-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone (PubChem CID 164687807) has the molecular formula C29H36N6O4S and a molecular weight of 564.71 g/mol. Its IUPAC name is 1-[15-(2-ethoxyacetyl)-18-oxa-3,6,10,15-tetrazatricyclo[17.3.1.02,6]tricosa-1(23),2,4,19,21-pentaen-10-yl]-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone.
| Compound Name | 1-[15-(2-ethoxyacetyl)-18-oxa-3,6,10,15-tetrazatricyclo[17.3.1.02,6]tricosa-1(23),2,4,19,21-pentaen-10-yl]-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone |
|---|---|
| PubChem CID | 164687807 |
| Molecular Formula | C29H36N6O4S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | 1-[15-(2-ethoxyacetyl)-18-oxa-3,6,10,15-tetrazatricyclo[17.3.1.02,6]tricosa-1(23),2,4,19,21-pentaen-10-yl]-2-imidazo[2,1-b][1,3]thiazol-6-ylethanone |
| SMILES | CCOCC(=O)N1CCCCN(C(=O)Cc2cn3ccsc3n2)CCCn2ccnc2-c2cccc(c2)OCC1 |
| InChI | InChI=1S/C29H36N6O4S/c1-2-38-22-27(37)33-11-4-3-10-32(26(36)20-24-21-35-16-18-40-29(35)31-24)12-6-13-34-14-9-30-28(34)23-7-5-8-25(19-23)39-17-15-33/h5,7-9,14,16,18-19,21H,2-4,6,10-13,15,17,20,22H2,1H3 |
| InChIKey | RUTARMYYWXQGMZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 94.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |