C24H33N3O3 — CID 164687911
(1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-(2-oxo-1H-pyridine-4-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164687911) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-(2-oxo-1H-pyridine-4-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-(2-oxo-1H-pyridine-4-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164687911 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-(2-oxo-1H-pyridine-4-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | O=C(c1cc[nH]c(=O)c1)N1C[C@H]2C[C@@H](C1)[C@H](CC1CCCCC1)N1C(=O)CCC[C@@H]21 |
| InChI | InChI=1S/C24H33N3O3/c28-22-13-17(9-10-25-22)24(30)26-14-18-12-19(15-26)21(11-16-5-2-1-3-6-16)27-20(18)7-4-8-23(27)29/h9-10,13,16,18-21H,1-8,11-12,14-15H2,(H,25,28)/t18-,19+,20+,21+/m1/s1 |
| InChIKey | ZAMGJENBXBUBSU-ANULTFPQSA-N |
| XLogP | 3.19 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |