C23H40N6O — CID 164688015
2-[5-[(1S)-1-amino-2-methylpropyl]-3-methyl-1,2,4-triazol-1-yl]-1-[(1R,2S,8S,9S)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethanone (PubChem CID 164688015) has the molecular formula C23H40N6O and a molecular weight of 416.61 g/mol. Its IUPAC name is 2-[5-[(1S)-1-amino-2-methylpropyl]-3-methyl-1,2,4-triazol-1-yl]-1-[(1R,2S,8S,9S)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethanone.
| Compound Name | 2-[5-[(1S)-1-amino-2-methylpropyl]-3-methyl-1,2,4-triazol-1-yl]-1-[(1R,2S,8S,9S)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethanone |
|---|---|
| PubChem CID | 164688015 |
| Molecular Formula | C23H40N6O |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | 2-[5-[(1S)-1-amino-2-methylpropyl]-3-methyl-1,2,4-triazol-1-yl]-1-[(1R,2S,8S,9S)-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]ethanone |
| SMILES | CCC[C@H]1[C@H]2C[C@H](CN(C(=O)Cn3nc(C)nc3[C@@H](N)C(C)C)C2)[C@@H]2CCCCN21 |
| InChI | InChI=1S/C23H40N6O/c1-5-8-19-17-11-18(20-9-6-7-10-28(19)20)13-27(12-17)21(30)14-29-23(22(24)15(2)3)25-16(4)26-29/h15,17-20,22H,5-14,24H2,1-4H3/t17-,18+,19-,20-,22-/m0/s1 |
| InChIKey | XPYVQHBBHQCHKB-XCRACJGTSA-N |
| XLogP | 2.74 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |