C26H33N3O6 — CID 164690043
(3S,7S)-13,22-dimethoxy-5-(2-methylpropyl)-2,15-dioxa-5,8,18-triazatetracyclo[18.2.2.110,14.03,7]pentacosa-1(22),10(25),11,13,20,23-hexaene-9,17-dione (PubChem CID 164690043) has the molecular formula C26H33N3O6 and a molecular weight of 483.57 g/mol. Its IUPAC name is (3S,7S)-13,22-dimethoxy-5-(2-methylpropyl)-2,15-dioxa-5,8,18-triazatetracyclo[18.2.2.110,14.03,7]pentacosa-1(22),10(25),11,13,20,23-hexaene-9,17-dione.
| Compound Name | (3S,7S)-13,22-dimethoxy-5-(2-methylpropyl)-2,15-dioxa-5,8,18-triazatetracyclo[18.2.2.110,14.03,7]pentacosa-1(22),10(25),11,13,20,23-hexaene-9,17-dione |
|---|---|
| PubChem CID | 164690043 |
| Molecular Formula | C26H33N3O6 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | (3S,7S)-13,22-dimethoxy-5-(2-methylpropyl)-2,15-dioxa-5,8,18-triazatetracyclo[18.2.2.110,14.03,7]pentacosa-1(22),10(25),11,13,20,23-hexaene-9,17-dione |
| SMILES | COc1ccc2cc1OCC(=O)NCc1ccc(c(OC)c1)O[C@H]1CN(CC(C)C)C[C@@H]1NC2=O |
| InChI | InChI=1S/C26H33N3O6/c1-16(2)12-29-13-19-24(14-29)35-21-7-5-17(9-22(21)33-4)11-27-25(30)15-34-23-10-18(26(31)28-19)6-8-20(23)32-3/h5-10,16,19,24H,11-15H2,1-4H3,(H,27,30)(H,28,31)/t19-,24-/m0/s1 |
| InChIKey | RWZPZVANMSWEBC-CYFREDJKSA-N |
| XLogP | 2.23 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |