C26H33N3O2 — CID 164690253
(1R,2S,8S,9S)-11-(4,6-dimethyl-2-pyridinyl)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164690253) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is (1R,2S,8S,9S)-11-(4,6-dimethyl-2-pyridinyl)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-11-(4,6-dimethyl-2-pyridinyl)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164690253 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | (1R,2S,8S,9S)-11-(4,6-dimethyl-2-pyridinyl)-8-[(3-methoxyphenyl)methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | COc1cccc(C[C@H]2[C@H]3C[C@H](CN(c4cc(C)cc(C)n4)C3)[C@@H]3CCCC(=O)N32)c1 |
| InChI | InChI=1S/C26H33N3O2/c1-17-10-18(2)27-25(11-17)28-15-20-14-21(16-28)24(29-23(20)8-5-9-26(29)30)13-19-6-4-7-22(12-19)31-3/h4,6-7,10-12,20-21,23-24H,5,8-9,13-16H2,1-3H3/t20-,21+,23+,24+/m1/s1 |
| InChIKey | TXMBHQQHRNGTCS-KJBBBAAKSA-N |
| XLogP | 4.16 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |